CAS 1286776-73-5 is the registry number for 2-Chloro-5-(chlorodifluoromethoxy)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-5-[chloro(difluoro)methoxy]pyridine (CAS 1286776-73-5) is a chemical compound with the molecular formula C6H3Cl2F2NO and a molecular weight of 213.99 g/mol. IUPAC name: 2-chloro-5-[chloro(difluoro)methoxy]pyridine. InChIKey: WHUYCOMPLSDMQI-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2NO |
|---|---|
| Molecular weight | 213.99 g/mol |
| IUPAC name | 2-chloro-5-[chloro(difluoro)methoxy]pyridine |
| InChIKey | WHUYCOMPLSDMQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OC(F)(F)Cl)Cl |
Computed by PubChem (NCBI)