CAS 1214329-50-6 is the registry number for 2,5-Dichloro-4-(difluoromethoxy)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,5-dichloro-4-(difluoromethoxy)pyridine (CAS 1214329-50-6) is a chemical compound with the molecular formula C6H3Cl2F2NO and a molecular weight of 213.99 g/mol. IUPAC name: 2,5-dichloro-4-(difluoromethoxy)pyridine. InChIKey: SRFOGVINMHZIMJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2NO |
|---|---|
| Molecular weight | 213.99 g/mol |
| IUPAC name | 2,5-dichloro-4-(difluoromethoxy)pyridine |
| InChIKey | SRFOGVINMHZIMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Cl)OC(F)F |
Computed by PubChem (NCBI)