CAS 1108658-38-3 is the registry number for tert-Butyl N-((1-formylcyclopropyl)sulfonyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-(1-formylcyclopropyl)sulfonylcarbamate (CAS 1108658-38-3) is a chemical compound with the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. IUPAC name: tert-butyl N-(1-formylcyclopropyl)sulfonylcarbamate. InChIKey: SHRAAPJUZKMNEU-UHFFFAOYSA-N.
| Molecular formula | C9H15NO5S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | tert-butyl N-(1-formylcyclopropyl)sulfonylcarbamate |
| InChIKey | SHRAAPJUZKMNEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)C1(CC1)C=O |
Computed by PubChem (NCBI)