Products 73614-35-4

CAS 73614-35-4 is the registry number for N-Acetyl-S-(2-carboxypropyl)-L-cysteine bis(dicyclohexylammonium) (Mixture of Diastereomers). Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-methylpropanoic acid (CAS 73614-35-4) is a chemical compound with the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. IUPAC name: 3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-methylpropanoic acid. InChIKey: NCVHUCCOTCVUCB-MSZQBOFLSA-N.

Identity
Molecular formulaC9H15NO5S
Molecular weight249.29 g/mol
IUPAC name3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-methylpropanoic acid
InChIKeyNCVHUCCOTCVUCB-MSZQBOFLSA-N
SMILESCC(CSC[C@@H](C(=O)O)NC(=O)C)C(=O)O

Computed by PubChem (NCBI)