Products 33164-65-7

CAS 33164-65-7 is the registry number for 3-(((R)-2-Acetamido-2-carboxyethyl)thio)butanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(2R)-2-acetamido-2-carboxyethyl]sulfanylbutanoic acid (CAS 33164-65-7) is a chemical compound with the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. IUPAC name: 3-[(2R)-2-acetamido-2-carboxyethyl]sulfanylbutanoic acid. InChIKey: NZLXIGKXJUXPAV-MSZQBOFLSA-N.

Identity
Molecular formulaC9H15NO5S
Molecular weight249.29 g/mol
IUPAC name3-[(2R)-2-acetamido-2-carboxyethyl]sulfanylbutanoic acid
InChIKeyNZLXIGKXJUXPAV-MSZQBOFLSA-N
SMILESCC(CC(=O)O)SC[C@@H](C(=O)O)NC(=O)C

Computed by PubChem (NCBI)