CAS 1108683-66-4 appears in our catalog under these names: (R)-4-(1-Aminoethyl)benzoic acid, 95%, (R)-4-(1-Aminoethyl)benzoic acid, 98%, (R)-4-(1-Aminoethyl)benzoic Acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g.
4-[(1R)-1-aminoethyl]benzoic acid (CAS 1108683-66-4) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]benzoic acid. InChIKey: NDMBVGSUFFPAFE-ZCFIWIBFSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]benzoic acid |
| InChIKey | NDMBVGSUFFPAFE-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)O)N |
Computed by PubChem (NCBI)