CAS 222714-33-2 appears in our catalog under these names: (S)–4–(1–Aminoethyl)benzoic acid, (S)-4-(1-Aminoethyl)benzoic acid, 97%, 97%, (S)-4-(1-Aminoethyl)benzoic acid, 96%, (S)-4-(1-Aminoethyl)benzoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
4-[(1S)-1-aminoethyl]benzoic acid (CAS 222714-33-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]benzoic acid. InChIKey: NDMBVGSUFFPAFE-LURJTMIESA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]benzoic acid |
| InChIKey | NDMBVGSUFFPAFE-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(=O)O)N |
Computed by PubChem (NCBI)