CAS 1108750-62-4 is the registry number for Nile Red phenoxyacetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]oxyacetic acid (CAS 1108750-62-4) is a chemical compound with the molecular formula C22H20N2O5 and a molecular weight of 392.4 g/mol. IUPAC name: 2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]oxyacetic acid. InChIKey: BFJPDIOLUBQYFN-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O5 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]oxyacetic acid |
| InChIKey | BFJPDIOLUBQYFN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C(=CC(=O)C4=C3C=C(C=C4)OCC(=O)O)O2 |
Computed by PubChem (NCBI)