Products 1598416-05-7
CAS 1598416-05-7 appears in our catalog under these names: Tadalafil Impurity X, Tadalafil Impurity 4, (1R,3R)-Methyl 2-acetyl-1-(benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, 95%, Tadalafil Impurity 23. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (1R,3R)-2-acetyl-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (CAS 1598416-05-7) is a chemical compound with the molecular formula C22H20N2O5 and a molecular weight of 392.4 g/mol. IUPAC name: methyl (1R,3R)-2-acetyl-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate. InChIKey: QCIPMWHCEPSHOW-DYESRHJHSA-N.
| Molecular formula | C22H20N2O5 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | methyl (1R,3R)-2-acetyl-1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| InChIKey | QCIPMWHCEPSHOW-DYESRHJHSA-N |
| SMILES | CC(=O)N1[C@H](CC2=C([C@H]1C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Tadalafil Impurity 42, Tadalafil Impurity X