CAS 1585210-50-9 is the registry number for Methyl 1-(3,4,5-trimethoxyphenyl)-9H-pyrido(3,4-b)indole-3-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
Methyl 1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate (CAS 1585210-50-9) is a chemical compound with the molecular formula C22H20N2O5 and a molecular weight of 392.4 g/mol. IUPAC name: methyl 1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: BXGZXFNSZXHQOA-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O5 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | methyl 1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | BXGZXFNSZXHQOA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=C3C(=CC(=N2)C(=O)OC)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)