CAS 110968-70-2 appears in our catalog under these names: 6,7-Diamino-2,2,3,3-tetrafluoro-1,4-benzodioxane, 95%, 6,7-Diamino-2,2,3,3-tetrafluoro-1,4-benzodioxane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2,2,3,3-tetrafluoro-1,4-benzodioxine-6,7-diamine (CAS 110968-70-2) is a chemical compound with the molecular formula C8H6F4N2O2 and a molecular weight of 238.14 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-1,4-benzodioxine-6,7-diamine. InChIKey: YRIFFQGLVKTXHO-UHFFFAOYSA-N.
| Molecular formula | C8H6F4N2O2 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-1,4-benzodioxine-6,7-diamine |
| InChIKey | YRIFFQGLVKTXHO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(C(O2)(F)F)(F)F)N)N |
Computed by PubChem (NCBI)