Products 1270319-55-5

CAS 1270319-55-5 is the registry number for 2-Amino-2-(3-fluoro-2-(trifluoromethyl)pyridin-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-2-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]acetic acid (CAS 1270319-55-5) is a chemical compound with the molecular formula C8H6F4N2O2 and a molecular weight of 238.14 g/mol. IUPAC name: 2-amino-2-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]acetic acid. InChIKey: MUMXOGYCZFBZQW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F4N2O2
Molecular weight238.14 g/mol
IUPAC name2-amino-2-[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]acetic acid
InChIKeyMUMXOGYCZFBZQW-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1C(C(=O)O)N)F)C(F)(F)F

Computed by PubChem (NCBI)