CAS 1391302-88-7 appears in our catalog under these names: 2,2,2-Trifluoro-1-(2-fluoro-3-nitrophenyl)ethan-1-amine, 95%, 2,2,2-Trifluoro-1-(2-fluoro-3-nitrophenyl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2,2-trifluoro-1-(2-fluoro-3-nitrophenyl)ethanamine (CAS 1391302-88-7) is a chemical compound with the molecular formula C8H6F4N2O2 and a molecular weight of 238.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluoro-3-nitrophenyl)ethanamine. InChIKey: RPPLHJLOAZCLFS-UHFFFAOYSA-N.
| Molecular formula | C8H6F4N2O2 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluoro-3-nitrophenyl)ethanamine |
| InChIKey | RPPLHJLOAZCLFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)C(C(F)(F)F)N |
Computed by PubChem (NCBI)