CAS 110993-40-3 appears in our catalog under these names: N-tert-Butyl-3,5-dimethylaniline, 98%, N-(tert-Butyl)-3,5-dimethylaniline, 98%, N–tert–Butyl–3,5–dimethylaniline, N-tert-Butyl-3,5-dimethylaniline, >98.0%(GC)(T), N-tert-Butyl-3,5-dimethylaniline. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg, 25g.
N-tert-butyl-3,5-dimethylaniline (CAS 110993-40-3) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: N-tert-butyl-3,5-dimethylaniline. InChIKey: HMWHVIXDKZHDEO-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | N-tert-butyl-3,5-dimethylaniline |
| InChIKey | HMWHVIXDKZHDEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(C)(C)C)C |
Computed by PubChem (NCBI)