CAS 111011-80-4 is the registry number for 1-(5,5-Dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-yl)propan-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)propan-2-one (CAS 111011-80-4) is a chemical compound with the molecular formula C8H15O4P and a molecular weight of 206.18 g/mol. IUPAC name: 1-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)propan-2-one. InChIKey: UKUZWKGFVBSNHO-UHFFFAOYSA-N.
| Molecular formula | C8H15O4P |
|---|---|
| Molecular weight | 206.18 g/mol |
| IUPAC name | 1-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)propan-2-one |
| InChIKey | UKUZWKGFVBSNHO-UHFFFAOYSA-N |
| SMILES | CC(=O)CP1(=O)OCC(CO1)(C)C |
Computed by PubChem (NCBI)