CAS 54543-04-3 is the registry number for Dimethyl (E)-(3-Methyl-2-oxopent-3-en-1-yl)phosphonate. Offered by: TRC. Available pack sizes: 250mg.
(E)-1-dimethoxyphosphoryl-3-methylpent-3-en-2-one (CAS 54543-04-3) is a chemical compound with the molecular formula C8H15O4P and a molecular weight of 206.18 g/mol. IUPAC name: (E)-1-dimethoxyphosphoryl-3-methylpent-3-en-2-one. InChIKey: YTFZUPYEUDNYBO-FNORWQNLSA-N.
| Molecular formula | C8H15O4P |
|---|---|
| Molecular weight | 206.18 g/mol |
| IUPAC name | (E)-1-dimethoxyphosphoryl-3-methylpent-3-en-2-one |
| InChIKey | YTFZUPYEUDNYBO-FNORWQNLSA-N |
| SMILES | C/C=C(\C)/C(=O)CP(=O)(OC)OC |
Computed by PubChem (NCBI)