CAS 61481-19-4 is the registry number for 4-(tert-Butyl)-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane 1-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4-tert-butyl-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane 1-oxide (CAS 61481-19-4) is a chemical compound with the molecular formula C8H15O4P and a molecular weight of 206.18 g/mol. IUPAC name: 4-tert-butyl-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane 1-oxide. InChIKey: CNBZOKKOTFTYLW-UHFFFAOYSA-N.
| Molecular formula | C8H15O4P |
|---|---|
| Molecular weight | 206.18 g/mol |
| IUPAC name | 4-tert-butyl-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane 1-oxide |
| InChIKey | CNBZOKKOTFTYLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C12COP(=O)(OC1)OC2 |
Computed by PubChem (NCBI)