Products 1110650-74-2
CAS 1110650-74-2 appears in our catalog under these names: HFI–437, HFI-437, 99.64%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 50 mg, 25 mg, 5 mg.
Ethyl 2-acetamido-7-hydroxy-4-quinolin-3-yl-4H-chromene-3-carboxylate (CAS 1110650-74-2) is a chemical compound with the molecular formula C23H20N2O5 and a molecular weight of 404.4 g/mol. IUPAC name: ethyl 2-acetamido-7-hydroxy-4-quinolin-3-yl-4H-chromene-3-carboxylate. InChIKey: YOODOXUTKZODHS-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O5 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | ethyl 2-acetamido-7-hydroxy-4-quinolin-3-yl-4H-chromene-3-carboxylate |
| InChIKey | YOODOXUTKZODHS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC2=C(C1C3=CC4=CC=CC=C4N=C3)C=CC(=C2)O)NC(=O)C |
Computed by PubChem (NCBI)