Products 169555-96-8
CAS 169555-96-8 is the registry number for (S)-4-(2-N-Fmoc-2-carboxyethyl)pyridine 1-oxide, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-oxidopyridin-1-ium-4-yl)propanoic acid (CAS 169555-96-8) is a chemical compound with the molecular formula C23H20N2O5 and a molecular weight of 404.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-oxidopyridin-1-ium-4-yl)propanoic acid. InChIKey: NHQRNTNGIIMATI-NRFANRHFSA-N.
| Molecular formula | C23H20N2O5 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-oxidopyridin-1-ium-4-yl)propanoic acid |
| InChIKey | NHQRNTNGIIMATI-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=[N+](C=C4)[O-])C(=O)O |
Computed by PubChem (NCBI)