Products 2973753-27-2
CAS 2973753-27-2 is the registry number for (S)-2-(Fmoc-amino)-3-(2-oxo-1,2-dihydropyridin-4-yl)propanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-oxo-1H-pyridin-4-yl)propanoic acid (CAS 2973753-27-2) is a chemical compound with the molecular formula C23H20N2O5 and a molecular weight of 404.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-oxo-1H-pyridin-4-yl)propanoic acid. InChIKey: ZAIQHBGXBFQOPU-FQEVSTJZSA-N.
| Molecular formula | C23H20N2O5 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-oxo-1H-pyridin-4-yl)propanoic acid |
| InChIKey | ZAIQHBGXBFQOPU-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=O)NC=C4)C(=O)O |
Computed by PubChem (NCBI)