CAS 1110670-49-9 is the registry number for Caspase-3/7 Inhibitor I, 98.31%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
5-[2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione (CAS 1110670-49-9) is a chemical compound with the molecular formula C14H16N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: 5-[2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione. InChIKey: SLQMNVJNDYLJSF-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5S |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | 5-[2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione |
| InChIKey | SLQMNVJNDYLJSF-UHFFFAOYSA-N |
| SMILES | COCC1CCCN1S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3=O |
Computed by PubChem (NCBI)