Products 1110670-49-9

CAS 1110670-49-9 is the registry number for Caspase-3/7 Inhibitor I, 98.31%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

5-[2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione (CAS 1110670-49-9) is a chemical compound with the molecular formula C14H16N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: 5-[2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione. InChIKey: SLQMNVJNDYLJSF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O5S
Molecular weight324.35 g/mol
IUPAC name5-[2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione
InChIKeySLQMNVJNDYLJSF-UHFFFAOYSA-N
SMILESCOCC1CCCN1S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3=O

Computed by PubChem (NCBI)