Products 2190144-51-3
CAS 2190144-51-3 is the registry number for VP-4509. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-nitrophenyl)sulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol (CAS 2190144-51-3) is a chemical compound with the molecular formula C14H16N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: 4-(4-nitrophenyl)sulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol. InChIKey: KTCBXXFWPAHEHJ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5S |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | 4-(4-nitrophenyl)sulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| InChIKey | KTCBXXFWPAHEHJ-UHFFFAOYSA-N |
| SMILES | C1C2CC3C1CN(C3C2O)S(=O)(=O)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)