CAS 220509-74-0 appears in our catalog under these names: MMPSI, 98+%, MMPSI/ 99.74% (existing batch purity), Caspase–3/7 Inhibitor I, Caspase-3/7 Inhibitor I, MMPSI, ≥97%, ≥97%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 200mg.
5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione (CAS 220509-74-0) is a chemical compound with the molecular formula C14H16N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: 5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione. InChIKey: SLQMNVJNDYLJSF-VIFPVBQESA-N.
| Molecular formula | C14H16N2O5S |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | 5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione |
| InChIKey | SLQMNVJNDYLJSF-VIFPVBQESA-N |
| SMILES | COC[C@@H]1CCCN1S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3=O |
Computed by PubChem (NCBI)