CAS 111071-96-6 appears in our catalog under these names: Propiverine N-Oxide (Mixture of cis- and trans-Isomers), Propiverine N–oxide, Propiverine N-oxide. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 500μg, Get quote.
(1-methyl-1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate (CAS 111071-96-6) is a chemical compound with the molecular formula C23H29NO4 and a molecular weight of 383.5 g/mol. IUPAC name: (1-methyl-1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate. InChIKey: UCEROFWFVDOVSQ-UHFFFAOYSA-N.
| Molecular formula | C23H29NO4 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | (1-methyl-1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate |
| InChIKey | UCEROFWFVDOVSQ-UHFFFAOYSA-N |
| SMILES | CCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OC3CC[N+](CC3)(C)[O-] |
Computed by PubChem (NCBI)