CAS 189337-28-8 appears in our catalog under these names: Fmoc–Thr(tBu)–ol, Fmoc-L-Thr(tBu)-ol, Fmoc-O-tert-butyl-L-threoninol, FMOC-THR(TBU)-OL, 98%, 98%, Fmoc-Threoninol(OtBu), 97%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 2g, 10g, 50g, 250mg.
9H-fluoren-9-ylmethyl N-[(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamate (CAS 189337-28-8) is a chemical compound with the molecular formula C23H29NO4 and a molecular weight of 383.5 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamate. InChIKey: LBVPBNDGSCZOTB-QVKFZJNVSA-N.
| Molecular formula | C23H29NO4 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R,3R)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamate |
| InChIKey | LBVPBNDGSCZOTB-QVKFZJNVSA-N |
| SMILES | C[C@H]([C@@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)