CAS 1189357-56-9 is the registry number for (9H-Fluoren-9-yl)methyl ((2S,3S)-3-(tert-butoxy)-1-hydroxybutan-2-yl)carbamate, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
9H-fluoren-9-ylmethyl N-[(2S,3S)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamate (CAS 1189357-56-9) is a chemical compound with the molecular formula C23H29NO4 and a molecular weight of 383.5 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S,3S)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamate. InChIKey: LBVPBNDGSCZOTB-BTYIYWSLSA-N.
| Molecular formula | C23H29NO4 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S,3S)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]butan-2-yl]carbamate |
| InChIKey | LBVPBNDGSCZOTB-BTYIYWSLSA-N |
| SMILES | C[C@@H]([C@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)