CAS 1110767-01-5 appears in our catalog under these names: (Z)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid, 95%, 3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid, 97% mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
3,5-dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)benzoic acid (CAS 1110767-01-5) is a chemical compound with the molecular formula C13H12Cl2O4 and a molecular weight of 303.13 g/mol. IUPAC name: 3,5-dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)benzoic acid. InChIKey: YHVIKIKTANFPCN-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2O4 |
|---|---|
| Molecular weight | 303.13 g/mol |
| IUPAC name | 3,5-dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)benzoic acid |
| InChIKey | YHVIKIKTANFPCN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC1=C(C=C(C=C1Cl)C(=O)O)Cl)C |
Computed by PubChem (NCBI)