CAS 1110767-89-9 appears in our catalog under these names: (E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid, 95%, Lusutrombopag Impurity 1, (E)–3,5–Dichloro–4–(3–ethoxy–2–methyl–3–oxoprop–1–en–1–yl)benzoic acid, (E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, on request, 100mg.
3,5-dichloro-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]benzoic acid (CAS 1110767-89-9) is a chemical compound with the molecular formula C13H12Cl2O4 and a molecular weight of 303.13 g/mol. IUPAC name: 3,5-dichloro-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]benzoic acid. InChIKey: YHVIKIKTANFPCN-QPJJXVBHSA-N.
| Molecular formula | C13H12Cl2O4 |
|---|---|
| Molecular weight | 303.13 g/mol |
| IUPAC name | 3,5-dichloro-4-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | YHVIKIKTANFPCN-QPJJXVBHSA-N |
| SMILES | CCOC(=O)/C(=C/C1=C(C=C(C=C1Cl)C(=O)O)Cl)/C |
Computed by PubChem (NCBI)