Products 1110940-89-0
CAS 1110940-89-0 is the registry number for 5,6-Dimethyl-3-(4-methylpiperidin-1-yl)pyridazine-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethyl-3-(4-methylpiperidin-1-yl)pyridazine-4-carbonitrile (CAS 1110940-89-0) is a chemical compound with the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. IUPAC name: 5,6-dimethyl-3-(4-methylpiperidin-1-yl)pyridazine-4-carbonitrile. InChIKey: BMIXTTQSYSTZCS-UHFFFAOYSA-N.
| Molecular formula | C13H18N4 |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | 5,6-dimethyl-3-(4-methylpiperidin-1-yl)pyridazine-4-carbonitrile |
| InChIKey | BMIXTTQSYSTZCS-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C(=C(N=N2)C)C)C#N |
Computed by PubChem (NCBI)