CAS 313518-69-3 appears in our catalog under these names: 2-(Piperidin-1-ylmethyl)-1H-1,3-benzodiazol-6-amine, 95%, 2-(Piperidin-1-ylmethyl)-1H-1,3-benzodiazol-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(piperidin-1-ylmethyl)-3H-benzimidazol-5-amine (CAS 313518-69-3) is a chemical compound with the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. IUPAC name: 2-(piperidin-1-ylmethyl)-3H-benzimidazol-5-amine. InChIKey: BOCXJGQDJLZNQU-UHFFFAOYSA-N.
| Molecular formula | C13H18N4 |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | 2-(piperidin-1-ylmethyl)-3H-benzimidazol-5-amine |
| InChIKey | BOCXJGQDJLZNQU-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=NC3=C(N2)C=C(C=C3)N |
Computed by PubChem (NCBI)