CAS 1803580-80-4 appears in our catalog under these names: 3-tert-Butyl-1-(pyridin-2-ylmethyl)-1H-pyrazol-5-amine, 95%, 3-tert-Butyl-1-(pyridin-2-ylmethyl)-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-tert-butyl-1-(pyridin-2-ylmethyl)pyrazol-5-amine (CAS 1803580-80-4) is a chemical compound with the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. IUPAC name: 3-tert-butyl-1-(pyridin-2-ylmethyl)pyrazol-5-amine. InChIKey: BDHYFKFJMIHAHX-UHFFFAOYSA-N.
| Molecular formula | C13H18N4 |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | 3-tert-butyl-1-(pyridin-2-ylmethyl)pyrazol-5-amine |
| InChIKey | BDHYFKFJMIHAHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)CC2=CC=CC=N2 |
Computed by PubChem (NCBI)