CAS 1111096-31-1 is the registry number for 1–(5–(4,4,5,5–TETRAMETHYL–1,3,2–DIOXABOROLAN–2–YL)FURAN–3–YL)ETHANONE. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]ethanone (CAS 1111096-31-1) is a chemical compound with the molecular formula C12H17BO4 and a molecular weight of 236.07 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]ethanone. InChIKey: HHSQTXFBMYFPOP-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-yl]ethanone |
| InChIKey | HHSQTXFBMYFPOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CO2)C(=O)C |
Computed by PubChem (NCBI)