CAS 193905-91-8 appears in our catalog under these names: Benzoic acid, 3-borono-5-(1,1-dimethylethyl)-, 1-methyl ester, 98%, Benzoic acid, 3-borono-5-(1,1-dimethylethyl)-, 1-methyl ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(3-tert-butyl-5-methoxycarbonylphenyl)boronic acid (CAS 193905-91-8) is a chemical compound with the molecular formula C12H17BO4 and a molecular weight of 236.07 g/mol. IUPAC name: (3-tert-butyl-5-methoxycarbonylphenyl)boronic acid. InChIKey: ZZOYTJILBZJPGA-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | (3-tert-butyl-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | ZZOYTJILBZJPGA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)