Products 2095372-76-0
CAS 2095372-76-0 appears in our catalog under these names: 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diol, 95%, 95%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diol, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diol (CAS 2095372-76-0) is a chemical compound with the molecular formula C12H17BO4 and a molecular weight of 236.07 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diol. InChIKey: GWZUWUOHZWOGLC-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diol |
| InChIKey | GWZUWUOHZWOGLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)