CAS 1111110-07-6 is the registry number for 2-Hydroxy-5-(4-methoxy-2-methylphenyl)pyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(4-methoxy-2-methylphenyl)-1H-pyridin-2-one (CAS 1111110-07-6) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 5-(4-methoxy-2-methylphenyl)-1H-pyridin-2-one. InChIKey: BZGPFIHUOQHWIH-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 5-(4-methoxy-2-methylphenyl)-1H-pyridin-2-one |
| InChIKey | BZGPFIHUOQHWIH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)