CAS 1111110-50-9 is the registry number for 6-(4-Cyanophenyl)-2-hydroxypyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(6-oxo-1H-pyridin-2-yl)benzonitrile (CAS 1111110-50-9) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 4-(6-oxo-1H-pyridin-2-yl)benzonitrile. InChIKey: CFHFDLIQRSYELI-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 4-(6-oxo-1H-pyridin-2-yl)benzonitrile |
| InChIKey | CFHFDLIQRSYELI-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)