Products 1111556-07-0
CAS 1111556-07-0 is the registry number for 6-Chloro-N4-(2-phenoxyethyl)pyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-(2-phenoxyethyl)pyrimidine-2,4-diamine (CAS 1111556-07-0) is a chemical compound with the molecular formula C12H13ClN4O and a molecular weight of 264.71 g/mol. IUPAC name: 6-chloro-4-N-(2-phenoxyethyl)pyrimidine-2,4-diamine. InChIKey: DIGBBIXGCPTEGK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4O |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 6-chloro-4-N-(2-phenoxyethyl)pyrimidine-2,4-diamine |
| InChIKey | DIGBBIXGCPTEGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCNC2=CC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)