Products 1245648-29-6
CAS 1245648-29-6 appears in our catalog under these names: 5–Chloro–N3–(4–methoxybenzyl)pyridazine–3，4–diamine, 5-Chloro-N3-(4-methoxybenzyl)pyridazine-3,4-diamine, 98%, 98%, 5-CHLORO-N3-(4-METHOXYBENZYL)PYRIDAZINE-3,4-DIAMINE, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-3-N-[(4-methoxyphenyl)methyl]pyridazine-3,4-diamine (CAS 1245648-29-6) is a chemical compound with the molecular formula C12H13ClN4O and a molecular weight of 264.71 g/mol. IUPAC name: 5-chloro-3-N-[(4-methoxyphenyl)methyl]pyridazine-3,4-diamine. InChIKey: LAADLWURSBQCPT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4O |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 5-chloro-3-N-[(4-methoxyphenyl)methyl]pyridazine-3,4-diamine |
| InChIKey | LAADLWURSBQCPT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C(=CN=N2)Cl)N |
Computed by PubChem (NCBI)