CAS 1421601-84-4 is the registry number for 2-Chloro-N-(5-methyl-2-(5-methyl-4H-1,2,4-triazol-3-yl)phenyl)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-N-[5-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide (CAS 1421601-84-4) is a chemical compound with the molecular formula C12H13ClN4O and a molecular weight of 264.71 g/mol. IUPAC name: 2-chloro-N-[5-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide. InChIKey: ZIFUKRXYTLSTRZ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4O |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 2-chloro-N-[5-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]acetamide |
| InChIKey | ZIFUKRXYTLSTRZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NNC(=N2)C)NC(=O)CCl |
Computed by PubChem (NCBI)