Products 1111637-66-1
CAS 1111637-66-1 is the registry number for tert-Butyl 5-bromo-3-methyl-2,3-dihydro-1h-pyrrolo[2,3-b]pyridine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
Tert-butyl 5-bromo-3-methyl-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1111637-66-1) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: tert-butyl 5-bromo-3-methyl-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: CJZVQZYRIKGSRJ-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2 |
|---|---|
| Molecular weight | 313.19 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-methyl-2,3-dihydropyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | CJZVQZYRIKGSRJ-UHFFFAOYSA-N |
| SMILES | CC1CN(C2=C1C=C(C=N2)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)