Products 2270906-81-3

CAS 2270906-81-3 is the registry number for 5-Bromo-2-cyclopropylamino-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-2-(cyclopropylamino)pyridine-3-carboxylate (CAS 2270906-81-3) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: tert-butyl 5-bromo-2-(cyclopropylamino)pyridine-3-carboxylate. InChIKey: LOONDIDORJXJFS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BrN2O2
Molecular weight313.19 g/mol
IUPAC nametert-butyl 5-bromo-2-(cyclopropylamino)pyridine-3-carboxylate
InChIKeyLOONDIDORJXJFS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(N=CC(=C1)Br)NC2CC2

Computed by PubChem (NCBI)