CAS 1375301-99-7 appears in our catalog under these names: 7-Bromo-1,2,3,4-tetrahydro-1,8-naphthyridine, n1-boc protected, 95%, tert-Butyl 7-bromo-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 7-bromo-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (CAS 1375301-99-7) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: tert-butyl 7-bromo-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate. InChIKey: ZXLYARHQBXPHOR-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2 |
|---|---|
| Molecular weight | 313.19 g/mol |
| IUPAC name | tert-butyl 7-bromo-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| InChIKey | ZXLYARHQBXPHOR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1N=C(C=C2)Br |
Computed by PubChem (NCBI)