CAS 111188-70-6 appears in our catalog under these names: Diltiazem Epimer, Diltiazem Impurity 13, Diltiazem Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2S,3R)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (CAS 111188-70-6) is a chemical compound with the molecular formula C22H26N2O4S and a molecular weight of 414.5 g/mol. IUPAC name: [(2S,3R)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate. InChIKey: HSUGRBWQSSZJOP-SFTDATJTSA-N.
| Molecular formula | C22H26N2O4S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | [(2S,3R)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| InChIKey | HSUGRBWQSSZJOP-SFTDATJTSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)