CAS 687569-15-9 appears in our catalog under these names: 5-(N,N-Diethylsulfamoyl)-3-methyl-N-(4-methylbenzyl)benzofuran-2-carboxamide, 98%, WAY-327370-10mMinDMSO,,, ≥98%, ≥98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
5-(diethylsulfamoyl)-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide (CAS 687569-15-9) is a chemical compound with the molecular formula C22H26N2O4S and a molecular weight of 414.5 g/mol. IUPAC name: 5-(diethylsulfamoyl)-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide. InChIKey: IWCIOFDUBLCTDD-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O4S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 5-(diethylsulfamoyl)-3-methyl-N-[(4-methylphenyl)methyl]-1-benzofuran-2-carboxamide |
| InChIKey | IWCIOFDUBLCTDD-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC2=C(C=C1)OC(=C2C)C(=O)NCC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)