Products 111188-71-7
CAS 111188-71-7 appears in our catalog under these names: Diltiazem EP Impurity A (2-Epi isomer), Diltiazem EP Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (CAS 111188-71-7) is a chemical compound with the molecular formula C22H26N2O4S and a molecular weight of 414.5 g/mol. IUPAC name: [(2R,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate. InChIKey: HSUGRBWQSSZJOP-NHCUHLMSSA-N.
| Molecular formula | C22H26N2O4S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | [(2R,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| InChIKey | HSUGRBWQSSZJOP-NHCUHLMSSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)