Products 64154-10-5
CAS 64154-10-5 appears in our catalog under these names: 3-(5-Bromofuran-2-yl)acrylic acid, 95%, 95%, 3-(5-Bromo-furan-2-yl)-acrylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(E)-3-(5-bromofuran-2-yl)prop-2-enoic acid (CAS 64154-10-5) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: (E)-3-(5-bromofuran-2-yl)prop-2-enoic acid. InChIKey: IIMYTCICBUBFJH-DUXPYHPUSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | (E)-3-(5-bromofuran-2-yl)prop-2-enoic acid |
| InChIKey | IIMYTCICBUBFJH-DUXPYHPUSA-N |
| SMILES | C1=C(OC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(5-bromofuran-2-yl)prop-2-enoic acid, 3-(5-Bromo-furan-2-yl)-acrylic acid, 3-(5-bromofuran-2-yl)prop-2-enoic acid, (E)-3-(5-bromofuran-2-yl)prop-2-enoic acid, 3-(5-bromofuran-2-yl)acrylic acid, (2E)-3-(5-bromofuran-2-yl)prop-2-enoic acid, E, (E)-3-(5-Bromo-2-furanyl)acrylic Acid, trans-3-(5-bromofuran-2-yl)propenoic acid, 2-Propenoic acid, 3-(5-bromo-2-furanyl)-, 3-(5-Bromo-2-furanyl)acrylic Acid