CAS 111293-23-3 appears in our catalog under these names: (-)-Bis(S)-1-(Ethoxycarbonyl)ethyl fumarate, (-)-Bis(S)-1-(Ethoxycarbonyl)ethyl fumar, ate, 2 g. Offered by: Biosynth, Roth. Available pack sizes: 2g.
Bis[(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-but-2-enedioate (CAS 111293-23-3) is a chemical compound with the molecular formula C14H20O8 and a molecular weight of 316.30 g/mol. IUPAC name: bis[(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-but-2-enedioate. InChIKey: PVSLHMRMQFZKMW-GOPXOUGQSA-N.
| Molecular formula | C14H20O8 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | bis[(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-but-2-enedioate |
| InChIKey | PVSLHMRMQFZKMW-GOPXOUGQSA-N |
| SMILES | CCOC(=O)[C@H](C)OC(=O)/C=C/C(=O)O[C@@H](C)C(=O)OCC |
Computed by PubChem (NCBI)