CAS 4337-04-6 appears in our catalog under these names: L-Ascorbyl 2,6-dibutyrate, 95%, L-Ascorbyl 2,6-Dibutyrate, >98.0%(T), L-Ascorbyl 2,6-Dibutyrate, L-Ascorbic acid, 2,6-dibutanoate. Offered by: Combi-blocks, AmBeed, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 200mg, 1 g, 250 mg, 100 mg.
[(2S)-2-[(2R)-4-butanoyloxy-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] butanoate (CAS 4337-04-6) is a chemical compound with the molecular formula C14H20O8 and a molecular weight of 316.30 g/mol. IUPAC name: [(2S)-2-[(2R)-4-butanoyloxy-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] butanoate. InChIKey: BFXWCTCPRAYDEB-QPUJVOFHSA-N.
| Molecular formula | C14H20O8 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | [(2S)-2-[(2R)-4-butanoyloxy-3-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] butanoate |
| InChIKey | BFXWCTCPRAYDEB-QPUJVOFHSA-N |
| SMILES | CCCC(=O)OC[C@@H]([C@@H]1C(=C(C(=O)O1)OC(=O)CCC)O)O |
Computed by PubChem (NCBI)