Products 1383997-16-7
CAS 1383997-16-7 is the registry number for Vanillin alcohol glucoside. Offered by: Biosynth. Available pack sizes: 50mg.
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-[4-(hydroxymethyl)-2-methoxyphenoxy]oxane-3,4,5-triol (CAS 1383997-16-7) is a chemical compound with the molecular formula C14H20O8 and a molecular weight of 316.30 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[4-(hydroxymethyl)-2-methoxyphenoxy]oxane-3,4,5-triol. InChIKey: SIMPNXWTAVEOTO-RQICVUQASA-N.
| Molecular formula | C14H20O8 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[4-(hydroxymethyl)-2-methoxyphenoxy]oxane-3,4,5-triol |
| InChIKey | SIMPNXWTAVEOTO-RQICVUQASA-N |
| SMILES | COC1=C(C=CC(=C1)CO)OC2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)