CAS 1112968-95-2 is the registry number for 1-(4-Amino-2,3,6-trifluorophenyl)-2,3-dihydropyridin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-amino-2,3,6-trifluorophenyl)-2,3-dihydropyridin-4-one (CAS 1112968-95-2) is a chemical compound with the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. IUPAC name: 1-(4-amino-2,3,6-trifluorophenyl)-2,3-dihydropyridin-4-one. InChIKey: HWIWLECBOSMZDU-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 1-(4-amino-2,3,6-trifluorophenyl)-2,3-dihydropyridin-4-one |
| InChIKey | HWIWLECBOSMZDU-UHFFFAOYSA-N |
| SMILES | C1CN(C=CC1=O)C2=C(C=C(C(=C2F)F)N)F |
Computed by PubChem (NCBI)